C30H33N3O5 — CID 67339020
[2-methoxy-5-[(E)-3-[4-(4-methylpiperazin-1-yl)-2-(phenoxymethyl)anilino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 67339020) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is [2-methoxy-5-[(E)-3-[4-(4-methylpiperazin-1-yl)-2-(phenoxymethyl)anilino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[(E)-3-[4-(4-methylpiperazin-1-yl)-2-(phenoxymethyl)anilino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67339020 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | [2-methoxy-5-[(E)-3-[4-(4-methylpiperazin-1-yl)-2-(phenoxymethyl)anilino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(N3CCN(C)CC3)cc2COc2ccccc2)cc1OC(C)=O |
| InChI | InChI=1S/C30H33N3O5/c1-22(34)38-29-19-23(9-13-28(29)36-3)10-14-30(35)31-27-12-11-25(33-17-15-32(2)16-18-33)20-24(27)21-37-26-7-5-4-6-8-26/h4-14,19-20H,15-18,21H2,1-3H3,(H,31,35)/b14-10+ |
| InChIKey | XONBORHALXFWGL-GXDHUFHOSA-N |
| XLogP | 4.60 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|