C31H34N2O6 — CID 67338746
[2-methoxy-5-[3-[2-[[3-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 67338746) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is [2-methoxy-5-[3-[2-[[3-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[3-[2-[[3-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 67338746 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | [2-methoxy-5-[3-[2-[[3-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]anilino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1ccc(C=CC(=O)Nc2ccccc2COc2cccc(OC3CCN(C)CC3)c2)cc1OC(C)=O |
| InChI | InChI=1S/C31H34N2O6/c1-22(34)38-30-19-23(11-13-29(30)36-3)12-14-31(35)32-28-10-5-4-7-24(28)21-37-26-8-6-9-27(20-26)39-25-15-17-33(2)18-16-25/h4-14,19-20,25H,15-18,21H2,1-3H3,(H,32,35) |
| InChIKey | BVBVMDDFDRBZSV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|