C31H34N2O5 — CID 143982482
[2-methoxy-5-[(E)-3-oxo-3-[2-[[4-(piperidin-4-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate (PubChem CID 143982482) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is [2-methoxy-5-[(E)-3-oxo-3-[2-[[4-(piperidin-4-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[(E)-3-oxo-3-[2-[[4-(piperidin-4-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 143982482 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | [2-methoxy-5-[(E)-3-oxo-3-[2-[[4-(piperidin-4-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] acetate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2COc2ccc(CC3CCNCC3)cc2)cc1OC(C)=O |
| InChI | InChI=1S/C31H34N2O5/c1-22(34)38-30-20-24(9-13-29(30)36-2)10-14-31(35)33-28-6-4-3-5-26(28)21-37-27-11-7-23(8-12-27)19-25-15-17-32-18-16-25/h3-14,20,25,32H,15-19,21H2,1-2H3,(H,33,35)/b14-10+ |
| InChIKey | MCKOCSLPVDFDRE-GXDHUFHOSA-N |
| XLogP | 5.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|