C31H31F3N2O5 — CID 77269905
[2-methoxy-5-[3-oxo-3-[2-[[4-(piperidin-1-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 77269905) has the molecular formula C31H31F3N2O5 and a molecular weight of 568.59 g/mol. Its IUPAC name is [2-methoxy-5-[3-oxo-3-[2-[[4-(piperidin-1-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-methoxy-5-[3-oxo-3-[2-[[4-(piperidin-1-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 77269905 |
| Molecular Formula | C31H31F3N2O5 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | [2-methoxy-5-[3-oxo-3-[2-[[4-(piperidin-1-ylmethyl)phenoxy]methyl]anilino]prop-1-enyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(C=CC(=O)Nc2ccccc2COc2ccc(CN3CCCCC3)cc2)cc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C31H31F3N2O5/c1-39-27-15-11-22(19-28(27)41-30(38)31(32,33)34)12-16-29(37)35-26-8-4-3-7-24(26)21-40-25-13-9-23(10-14-25)20-36-17-5-2-6-18-36/h3-4,7-16,19H,2,5-6,17-18,20-21H2,1H3,(H,35,37) |
| InChIKey | NFMLLDGFWYWCKO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|