C32H35NO6 — CID 118281630
[2-methoxy-5-[(E)-4-[2-[[4-(morpholin-4-ylmethyl)phenoxy]methyl]phenyl]-3-oxopent-1-enyl]phenyl] acetate (PubChem CID 118281630) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is [2-methoxy-5-[(E)-4-[2-[[4-(morpholin-4-ylmethyl)phenoxy]methyl]phenyl]-3-oxopent-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-5-[(E)-4-[2-[[4-(morpholin-4-ylmethyl)phenoxy]methyl]phenyl]-3-oxopent-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 118281630 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | [2-methoxy-5-[(E)-4-[2-[[4-(morpholin-4-ylmethyl)phenoxy]methyl]phenyl]-3-oxopent-1-enyl]phenyl] acetate |
| SMILES | COc1ccc(/C=C/C(=O)C(C)c2ccccc2COc2ccc(CN3CCOCC3)cc2)cc1OC(C)=O |
| InChI | InChI=1S/C32H35NO6/c1-23(30(35)14-10-25-11-15-31(36-3)32(20-25)39-24(2)34)29-7-5-4-6-27(29)22-38-28-12-8-26(9-13-28)21-33-16-18-37-19-17-33/h4-15,20,23H,16-19,21-22H2,1-3H3/b14-10+ |
| InChIKey | MQDQGPCFJQYHDW-GXDHUFHOSA-N |
| XLogP | 5.42 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|