C31H32FNO5 — CID 58387429
[2-fluoro-5-[(E)-4-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]-3-oxobut-1-enyl]phenyl] acetate (PubChem CID 58387429) has the molecular formula C31H32FNO5 and a molecular weight of 517.60 g/mol. Its IUPAC name is [2-fluoro-5-[(E)-4-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]-3-oxobut-1-enyl]phenyl] acetate.
| Compound Name | [2-fluoro-5-[(E)-4-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]-3-oxobut-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 58387429 |
| Molecular Formula | C31H32FNO5 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | [2-fluoro-5-[(E)-4-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]-3-oxobut-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(/C=C/C(=O)Cc2ccccc2COc2ccc(OC3CCN(C)CC3)cc2)ccc1F |
| InChI | InChI=1S/C31H32FNO5/c1-22(34)37-31-19-23(8-14-30(31)32)7-9-26(35)20-24-5-3-4-6-25(24)21-36-27-10-12-28(13-11-27)38-29-15-17-33(2)18-16-29/h3-14,19,29H,15-18,20-21H2,1-2H3/b9-7+ |
| InChIKey | HLFSSGFXZBKMJL-VQHVLOKHSA-N |
| XLogP | 5.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|