C29H29N3O4 — CID 67338201
3-(4-cyano-3-hydroxyphenyl)-N-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]prop-2-enamide (PubChem CID 67338201) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-(4-cyano-3-hydroxyphenyl)-N-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]prop-2-enamide.
| Compound Name | 3-(4-cyano-3-hydroxyphenyl)-N-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67338201 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-(4-cyano-3-hydroxyphenyl)-N-[2-[[4-(1-methylpiperidin-4-yl)oxyphenoxy]methyl]phenyl]prop-2-enamide |
| SMILES | CN1CCC(Oc2ccc(OCc3ccccc3NC(=O)C=Cc3ccc(C#N)c(O)c3)cc2)CC1 |
| InChI | InChI=1S/C29H29N3O4/c1-32-16-14-26(15-17-32)36-25-11-9-24(10-12-25)35-20-23-4-2-3-5-27(23)31-29(34)13-7-21-6-8-22(19-30)28(33)18-21/h2-13,18,26,33H,14-17,20H2,1H3,(H,31,34) |
| InChIKey | MSXASVYCAIQIDA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|