C35H42N2O8 — CID 143982400
tert-butyl 4-[3-[[6-[[(E)-3-(3-acetyloxy-4-methoxyphenyl)prop-2-enoyl]amino]cyclohexa-1,3-dien-1-yl]methoxy]phenoxy]piperidine-1-carboxylate (PubChem CID 143982400) has the molecular formula C35H42N2O8 and a molecular weight of 618.73 g/mol. Its IUPAC name is tert-butyl 4-[3-[[6-[[(E)-3-(3-acetyloxy-4-methoxyphenyl)prop-2-enoyl]amino]cyclohexa-1,3-dien-1-yl]methoxy]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[6-[[(E)-3-(3-acetyloxy-4-methoxyphenyl)prop-2-enoyl]amino]cyclohexa-1,3-dien-1-yl]methoxy]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143982400 |
| Molecular Formula | C35H42N2O8 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | tert-butyl 4-[3-[[6-[[(E)-3-(3-acetyloxy-4-methoxyphenyl)prop-2-enoyl]amino]cyclohexa-1,3-dien-1-yl]methoxy]phenoxy]piperidine-1-carboxylate |
| SMILES | COc1ccc(/C=C/C(=O)NC2CC=CC=C2COc2cccc(OC3CCN(C(=O)OC(C)(C)C)CC3)c2)cc1OC(C)=O |
| InChI | InChI=1S/C35H42N2O8/c1-24(38)43-32-21-25(13-15-31(32)41-5)14-16-33(39)36-30-12-7-6-9-26(30)23-42-28-10-8-11-29(22-28)44-27-17-19-37(20-18-27)34(40)45-35(2,3)4/h6-11,13-16,21-22,27,30H,12,17-20,23H2,1-5H3,(H,36,39)/b16-14+ |
| InChIKey | IZYRGXUIJCHJRO-JQIJEIRASA-N |
| XLogP | 5.86 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|