C27H24N2O4 — CID 58387394
[5-[(E)-4-(1-benzylindazol-7-yl)-3-oxobut-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 58387394) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is [5-[(E)-4-(1-benzylindazol-7-yl)-3-oxobut-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [5-[(E)-4-(1-benzylindazol-7-yl)-3-oxobut-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 58387394 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [5-[(E)-4-(1-benzylindazol-7-yl)-3-oxobut-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc(/C=C/C(=O)Cc2cccc3cnn(Cc4ccccc4)c23)cc1OC(C)=O |
| InChI | InChI=1S/C27H24N2O4/c1-19(30)33-26-15-20(12-14-25(26)32-2)11-13-24(31)16-22-9-6-10-23-17-28-29(27(22)23)18-21-7-4-3-5-8-21/h3-15,17H,16,18H2,1-2H3/b13-11+ |
| InChIKey | JUMQTBNSSMUIEC-ACCUITESSA-N |
| XLogP | 4.84 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|