C11H14O — CID 58388155
2,4-dimethyl-4-prop-1-en-2-ylcyclohexa-2,5-dien-1-one (PubChem CID 58388155) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 2,4-dimethyl-4-prop-1-en-2-ylcyclohexa-2,5-dien-1-one.
| Compound Name | 2,4-dimethyl-4-prop-1-en-2-ylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 58388155 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2,4-dimethyl-4-prop-1-en-2-ylcyclohexa-2,5-dien-1-one |
| SMILES | C=C(C)C1(C)C=CC(=O)C(C)=C1 |
| InChI | InChI=1S/C11H14O/c1-8(2)11(4)6-5-10(12)9(3)7-11/h5-7H,1H2,2-4H3 |
| InChIKey | SJWUUPGOBOUDKS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|