C11H12Br2O2 — CID 143697359
(2E,5Z,8Z)-4,7-dibromo-2-hydroxy-4,7-dimethylcyclonona-2,5,8-trien-1-one (PubChem CID 143697359) has the molecular formula C11H12Br2O2 and a molecular weight of 336.02 g/mol. Its IUPAC name is (2E,5Z,8Z)-4,7-dibromo-2-hydroxy-4,7-dimethylcyclonona-2,5,8-trien-1-one.
| Compound Name | (2E,5Z,8Z)-4,7-dibromo-2-hydroxy-4,7-dimethylcyclonona-2,5,8-trien-1-one |
|---|---|
| PubChem CID | 143697359 |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | (2E,5Z,8Z)-4,7-dibromo-2-hydroxy-4,7-dimethylcyclonona-2,5,8-trien-1-one |
| SMILES | CC1(Br)/C=C\C(=O)/C(O)=C\C(C)(Br)/C=C\1 |
| InChI | InChI=1S/C11H12Br2O2/c1-10(12)4-3-8(14)9(15)7-11(2,13)6-5-10/h3-7,15H,1-2H3/b4-3-,6-5-,9-7+ |
| InChIKey | CFCSAFOXVRUGOT-XMOCOHJPSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|