C10H13ClO2 — CID 162960958
2-[(1S)-1-chloro-2-hydroxyethyl]-4,4-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 162960958) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 2-[(1S)-1-chloro-2-hydroxyethyl]-4,4-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 2-[(1S)-1-chloro-2-hydroxyethyl]-4,4-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 162960958 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-[(1S)-1-chloro-2-hydroxyethyl]-4,4-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1(C)C=CC(=O)C([C@H](Cl)CO)=C1 |
| InChI | InChI=1S/C10H13ClO2/c1-10(2)4-3-9(13)7(5-10)8(11)6-12/h3-5,8,12H,6H2,1-2H3/t8-/m1/s1 |
| InChIKey | WMIMRGFYQPHFQY-MRVPVSSYSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|