2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid

C11H13FO2 — CID 123942878

IUPAC2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid
SMILESCC(C(=O)O)C1=CC(C)(F)C=CC=C1
InChIInChI=1S/C11H13FO2/c1-8(10(13)14)9-5-3-4-6-11(2,12)7-9/h3-8H,1-2H3,(H,13,14)
InChIKeySBWSAGPINDGJLM-UHFFFAOYSA-N
MW196.22 g/mol
LogP2.49
Rot. Bonds2

About 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid

2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid (PubChem CID 123942878) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid.

Molecular Properties

Compound Name2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid
PubChem CID123942878
Molecular FormulaC11H13FO2
Molecular Weight196.22 g/mol
Exact Mass196.09
IUPAC Name2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid
SMILESCC(C(=O)O)C1=CC(C)(F)C=CC=C1
InChIInChI=1S/C11H13FO2/c1-8(10(13)14)9-5-3-4-6-11(2,12)7-9/h3-8H,1-2H3,(H,13,14)
InChIKeySBWSAGPINDGJLM-UHFFFAOYSA-N
XLogP2.49
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.22
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid?
The IUPAC name of 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid (CID 123942878) is 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid.
What is the SMILES notation for 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid?
The canonical SMILES for 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid is CC(C(=O)O)C1=CC(C)(F)C=CC=C1.
What is the InChIKey of 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid?
The InChIKey is SBWSAGPINDGJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO2/c1-8(10(13)14)9-5-3-4-6-11(2,12)7-9/h3-8H,1-2H3,(H,13,14).
What are the key properties of 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid?
2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid has a molecular weight of 196.22 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-3-methylcyclohepta-1,4,6-trien-1-yl)propanoic acid is sourced from PubChem (CID 123942878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).