About fluoromethane;2-hydroxypropanoic acid
fluoromethane;2-hydroxypropanoic acid (PubChem CID 174688580) has the molecular formula C4H9FO3
and a molecular weight of 124.11 g/mol. Its IUPAC name is fluoromethane;2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | fluoromethane;2-hydroxypropanoic acid |
| PubChem CID | 174688580 |
| Molecular Formula | C4H9FO3 |
| Molecular Weight | 124.11 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | fluoromethane;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CF |
| InChI | InChI=1S/C3H6O3.CH3F/c1-2(4)3(5)6;1-2/h2,4H,1H3,(H,5,6);1H3 |
| InChIKey | CETMMHWTRQAOBD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.11 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoromethane;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;2-hydroxypropanoic acid?
The IUPAC name of fluoromethane;2-hydroxypropanoic acid (CID 174688580) is fluoromethane;2-hydroxypropanoic acid.
What is the SMILES notation for fluoromethane;2-hydroxypropanoic acid?
The canonical SMILES for fluoromethane;2-hydroxypropanoic acid is CC(O)C(=O)O.CF.
What is the InChIKey of fluoromethane;2-hydroxypropanoic acid?
The InChIKey is CETMMHWTRQAOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.CH3F/c1-2(4)3(5)6;1-2/h2,4H,1H3,(H,5,6);1H3.
What are the key properties of fluoromethane;2-hydroxypropanoic acid?
fluoromethane;2-hydroxypropanoic acid has a molecular weight of 124.11 g/mol, XLogP of 0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;2-hydroxypropanoic acid is sourced from PubChem (CID 174688580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).