C25H21F4N2O2Pt- — CID 58389302
2-(3,5-difluorobenzene-6-id-1-yl)-3-(3,5-difluorophenyl)quinoxaline;pentane-2,4-diol;platinum (PubChem CID 58389302) has the molecular formula C25H21F4N2O2Pt- and a molecular weight of 652.53 g/mol. Its IUPAC name is 2-(3,5-difluorobenzene-6-id-1-yl)-3-(3,5-difluorophenyl)quinoxaline;pentane-2,4-diol;platinum.
| Compound Name | 2-(3,5-difluorobenzene-6-id-1-yl)-3-(3,5-difluorophenyl)quinoxaline;pentane-2,4-diol;platinum |
|---|---|
| PubChem CID | 58389302 |
| Molecular Formula | C25H21F4N2O2Pt- |
| Molecular Weight | 652.53 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | 2-(3,5-difluorobenzene-6-id-1-yl)-3-(3,5-difluorophenyl)quinoxaline;pentane-2,4-diol;platinum |
| SMILES | CC(O)CC(C)O.Fc1[c-]c(-c2nc3ccccc3nc2-c2cc(F)cc(F)c2)cc(F)c1.[Pt] |
| InChI | InChI=1S/C20H9F4N2.C5H12O2.Pt/c21-13-5-11(6-14(22)9-13)19-20(12-7-15(23)10-16(24)8-12)26-18-4-2-1-3-17(18)25-19;1-4(6)3-5(2)7;/h1-7,9-10H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | STSAJSSDFCYWFA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|