C56H46N2 — CID 58389700
N-[3,5-bis(9,9-dimethylfluoren-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)pyridin-3-amine (PubChem CID 58389700) has the molecular formula C56H46N2 and a molecular weight of 747.00 g/mol. Its IUPAC name is N-[3,5-bis(9,9-dimethylfluoren-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)pyridin-3-amine.
| Compound Name | N-[3,5-bis(9,9-dimethylfluoren-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 58389700 |
| Molecular Formula | C56H46N2 |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.37 |
| IUPAC Name | N-[3,5-bis(9,9-dimethylfluoren-2-yl)phenyl]-N-(9,9-dimethylfluoren-2-yl)pyridin-3-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc(N(c4cccnc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)cc21 |
| InChI | InChI=1S/C56H46N2/c1-54(2)48-18-10-7-15-42(48)45-24-21-35(31-51(45)54)37-28-38(36-22-25-46-43-16-8-11-19-49(43)55(3,4)52(46)32-36)30-41(29-37)58(40-14-13-27-57-34-40)39-23-26-47-44-17-9-12-20-50(44)56(5,6)53(47)33-39/h7-34H,1-6H3 |
| InChIKey | RFGVBJUAOAFTRP-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |