C22H20BrClN2O4 — CID 58390501
N-[6-bromo-2-(4-chlorophenoxy)-3-pyridinyl]-N-[(2,5-dimethoxyphenyl)methyl]acetamide (PubChem CID 58390501) has the molecular formula C22H20BrClN2O4 and a molecular weight of 491.77 g/mol. Its IUPAC name is N-[6-bromo-2-(4-chlorophenoxy)-3-pyridinyl]-N-[(2,5-dimethoxyphenyl)methyl]acetamide.
| Compound Name | N-[6-bromo-2-(4-chlorophenoxy)-3-pyridinyl]-N-[(2,5-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 58390501 |
| Molecular Formula | C22H20BrClN2O4 |
| Molecular Weight | 491.77 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | N-[6-bromo-2-(4-chlorophenoxy)-3-pyridinyl]-N-[(2,5-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(OC)c(CN(C(C)=O)c2ccc(Br)nc2Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H20BrClN2O4/c1-14(27)26(13-15-12-18(28-2)8-10-20(15)29-3)19-9-11-21(23)25-22(19)30-17-6-4-16(24)5-7-17/h4-12H,13H2,1-3H3 |
| InChIKey | MFDJDMKYRPQVPB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.77 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|