C23H23FN2O4 — CID 91562091
N-[(2,5-dimethoxyphenyl)methyl]-N-[6-fluoro-2-(4-methylphenoxy)-3-pyridinyl]acetamide (PubChem CID 91562091) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-N-[6-fluoro-2-(4-methylphenoxy)-3-pyridinyl]acetamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-N-[6-fluoro-2-(4-methylphenoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 91562091 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-N-[6-fluoro-2-(4-methylphenoxy)-3-pyridinyl]acetamide |
| SMILES | COc1ccc(OC)c(CN(C(C)=O)c2ccc(F)nc2Oc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H23FN2O4/c1-15-5-7-18(8-6-15)30-23-20(10-12-22(24)25-23)26(16(2)27)14-17-13-19(28-3)9-11-21(17)29-4/h5-13H,14H2,1-4H3 |
| InChIKey | PFHBKUJVDGBBDZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|