C24H25FN2O6S — CID 174724479
[2-[[acetyl-[2-(2-fluorophenoxy)-3-pyridinyl]amino]methyl]-4-methoxyphenyl] propane-1-sulfonate (PubChem CID 174724479) has the molecular formula C24H25FN2O6S and a molecular weight of 488.54 g/mol. Its IUPAC name is [2-[[acetyl-[2-(2-fluorophenoxy)-3-pyridinyl]amino]methyl]-4-methoxyphenyl] propane-1-sulfonate.
| Compound Name | [2-[[acetyl-[2-(2-fluorophenoxy)-3-pyridinyl]amino]methyl]-4-methoxyphenyl] propane-1-sulfonate |
|---|---|
| PubChem CID | 174724479 |
| Molecular Formula | C24H25FN2O6S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [2-[[acetyl-[2-(2-fluorophenoxy)-3-pyridinyl]amino]methyl]-4-methoxyphenyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1ccc(OC)cc1CN(C(C)=O)c1cccnc1Oc1ccccc1F |
| InChI | InChI=1S/C24H25FN2O6S/c1-4-14-34(29,30)33-22-12-11-19(31-3)15-18(22)16-27(17(2)28)21-9-7-13-26-24(21)32-23-10-6-5-8-20(23)25/h5-13,15H,4,14,16H2,1-3H3 |
| InChIKey | WTFYKOGRZNYICT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|