C23H22ClFN2O3 — CID 70919061
N-[2-(4-chlorophenoxy)-3-pyridinyl]-N-[[5-ethyl-2-(fluoromethoxy)phenyl]methyl]acetamide (PubChem CID 70919061) has the molecular formula C23H22ClFN2O3 and a molecular weight of 428.89 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)-3-pyridinyl]-N-[[5-ethyl-2-(fluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)-3-pyridinyl]-N-[[5-ethyl-2-(fluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 70919061 |
| Molecular Formula | C23H22ClFN2O3 |
| Molecular Weight | 428.89 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[2-(4-chlorophenoxy)-3-pyridinyl]-N-[[5-ethyl-2-(fluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CCc1ccc(OCF)c(CN(C(C)=O)c2cccnc2Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H22ClFN2O3/c1-3-17-6-11-22(29-15-25)18(13-17)14-27(16(2)28)21-5-4-12-26-23(21)30-20-9-7-19(24)8-10-20/h4-13H,3,14-15H2,1-2H3 |
| InChIKey | VTXHEKHTPJDFHK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.89 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |