C26H29FN2O4 — CID 70919054
N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]-N-[2-[(4-methoxyphenyl)methyl]-3-pyridinyl]acetamide (PubChem CID 70919054) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]-N-[2-[(4-methoxyphenyl)methyl]-3-pyridinyl]acetamide.
| Compound Name | N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]-N-[2-[(4-methoxyphenyl)methyl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 70919054 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[[2-(3-fluoropropoxy)-5-methoxyphenyl]methyl]-N-[2-[(4-methoxyphenyl)methyl]-3-pyridinyl]acetamide |
| SMILES | COc1ccc(Cc2ncccc2N(Cc2cc(OC)ccc2OCCCF)C(C)=O)cc1 |
| InChI | InChI=1S/C26H29FN2O4/c1-19(30)29(18-21-17-23(32-3)11-12-26(21)33-15-5-13-27)25-6-4-14-28-24(25)16-20-7-9-22(31-2)10-8-20/h4,6-12,14,17H,5,13,15-16,18H2,1-3H3 |
| InChIKey | KKEAIYBOUHJUNC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|