C27H32N2O6S — CID 89100639
2-[2-[[acetyl-[2-[(2,3-dimethylphenyl)methyl]-3-pyridinyl]amino]methyl]-4-methoxyphenoxy]ethyl methanesulfonate (PubChem CID 89100639) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[2-[[acetyl-[2-[(2,3-dimethylphenyl)methyl]-3-pyridinyl]amino]methyl]-4-methoxyphenoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[[acetyl-[2-[(2,3-dimethylphenyl)methyl]-3-pyridinyl]amino]methyl]-4-methoxyphenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 89100639 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 2-[2-[[acetyl-[2-[(2,3-dimethylphenyl)methyl]-3-pyridinyl]amino]methyl]-4-methoxyphenoxy]ethyl methanesulfonate |
| SMILES | COc1ccc(OCCOS(C)(=O)=O)c(CN(C(C)=O)c2cccnc2Cc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C27H32N2O6S/c1-19-8-6-9-22(20(19)2)17-25-26(10-7-13-28-25)29(21(3)30)18-23-16-24(33-4)11-12-27(23)34-14-15-35-36(5,31)32/h6-13,16H,14-15,17-18H2,1-5H3 |
| InChIKey | QKWXZEYVRKISJM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|