C33H37ClN2O6S — CID 143936348
3-[2-[[acetyl-[2-(4-chlorophenoxy)-3-pyridinyl]amino]methyl]-4-methylphenoxy]propyl 4-methylbenzenesulfonate;ethane (PubChem CID 143936348) has the molecular formula C33H37ClN2O6S and a molecular weight of 625.19 g/mol. Its IUPAC name is 3-[2-[[acetyl-[2-(4-chlorophenoxy)-3-pyridinyl]amino]methyl]-4-methylphenoxy]propyl 4-methylbenzenesulfonate;ethane.
| Compound Name | 3-[2-[[acetyl-[2-(4-chlorophenoxy)-3-pyridinyl]amino]methyl]-4-methylphenoxy]propyl 4-methylbenzenesulfonate;ethane |
|---|---|
| PubChem CID | 143936348 |
| Molecular Formula | C33H37ClN2O6S |
| Molecular Weight | 625.19 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 3-[2-[[acetyl-[2-(4-chlorophenoxy)-3-pyridinyl]amino]methyl]-4-methylphenoxy]propyl 4-methylbenzenesulfonate;ethane |
| SMILES | CC.CC(=O)N(Cc1cc(C)ccc1OCCCOS(=O)(=O)c1ccc(C)cc1)c1cccnc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H31ClN2O6S.C2H6/c1-22-7-14-28(15-8-22)41(36,37)39-19-5-18-38-30-16-9-23(2)20-25(30)21-34(24(3)35)29-6-4-17-33-31(29)40-27-12-10-26(32)11-13-27;1-2/h4,6-17,20H,5,18-19,21H2,1-3H3;1-2H3 |
| InChIKey | OIFNVAONFZNJBT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.19 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|