C21H18F2N2O3 — CID 58390459
N-[6-fluoro-2-(4-fluorophenoxy)-3-pyridinyl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 58390459) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[6-fluoro-2-(4-fluorophenoxy)-3-pyridinyl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | N-[6-fluoro-2-(4-fluorophenoxy)-3-pyridinyl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 58390459 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[6-fluoro-2-(4-fluorophenoxy)-3-pyridinyl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CN(C(C)=O)c1ccc(F)nc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18F2N2O3/c1-14(26)25(13-15-5-3-4-6-19(15)27-2)18-11-12-20(23)24-21(18)28-17-9-7-16(22)8-10-17/h3-12H,13H2,1-2H3 |
| InChIKey | QTAPZOMHTJMIRO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|