C25H41BrMg — CID 58409825
magnesium;(6E,10E,14E,18E)-2,6,10,14,18-pentamethylicosa-2,6,10,14,18-pentaene;bromide (PubChem CID 58409825) has the molecular formula C25H41BrMg and a molecular weight of 445.81 g/mol. Its IUPAC name is magnesium;(6E,10E,14E,18E)-2,6,10,14,18-pentamethylicosa-2,6,10,14,18-pentaene;bromide.
| Compound Name | magnesium;(6E,10E,14E,18E)-2,6,10,14,18-pentamethylicosa-2,6,10,14,18-pentaene;bromide |
|---|---|
| PubChem CID | 58409825 |
| Molecular Formula | C25H41BrMg |
| Molecular Weight | 445.81 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | magnesium;(6E,10E,14E,18E)-2,6,10,14,18-pentamethylicosa-2,6,10,14,18-pentaene;bromide |
| SMILES | [Br-].[CH2-]/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C.[Mg+2] |
| InChI | InChI=1S/C25H41.BrH.Mg/c1-8-22(4)14-10-16-24(6)18-12-20-25(7)19-11-17-23(5)15-9-13-21(2)3;;/h8,13,16-17,20H,1,9-12,14-15,18-19H2,2-7H3;1H;/q-1;;+2/p-1/b22-8+,23-17+,24-16+,25-20+;; |
| InChIKey | ILORLHKQLZDRRD-JBMGQKTASA-M |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|