C26H22N2O4S2 — CID 58411272
6,18-dimethyl-7,19-bis(methylsulfonyl)-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene (PubChem CID 58411272) has the molecular formula C26H22N2O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 6,18-dimethyl-7,19-bis(methylsulfonyl)-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene.
| Compound Name | 6,18-dimethyl-7,19-bis(methylsulfonyl)-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene |
|---|---|
| PubChem CID | 58411272 |
| Molecular Formula | C26H22N2O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 6,18-dimethyl-7,19-bis(methylsulfonyl)-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene |
| SMILES | Cn1c(S(C)(=O)=O)cc2c3ccc4c(ccc5c4ccc4c5cc(S(C)(=O)=O)n4C)c3ccc21 |
| InChI | InChI=1S/C26H22N2O4S2/c1-27-23-11-9-17-15-6-8-20-18(10-12-24-22(20)14-26(28(24)2)34(4,31)32)16(15)5-7-19(17)21(23)13-25(27)33(3,29)30/h5-14H,1-4H3 |
| InChIKey | WGJZUYIHRDWIPR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|