C21H21N3O5 — CID 58417895
pyridin-3-yl 4-(7-methoxy-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate (PubChem CID 58417895) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is pyridin-3-yl 4-(7-methoxy-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate.
| Compound Name | pyridin-3-yl 4-(7-methoxy-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58417895 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | pyridin-3-yl 4-(7-methoxy-3-methyl-1-benzofuran-2-carbonyl)piperazine-1-carboxylate |
| SMILES | COc1cccc2c(C)c(C(=O)N3CCN(C(=O)Oc4cccnc4)CC3)oc12 |
| InChI | InChI=1S/C21H21N3O5/c1-14-16-6-3-7-17(27-2)19(16)29-18(14)20(25)23-9-11-24(12-10-23)21(26)28-15-5-4-8-22-13-15/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | SZWLVNGHISFDAN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |