About methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium
methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium (PubChem CID 58427650) has the molecular formula C14H14O3SY-2
and a molecular weight of 351.24 g/mol. Its IUPAC name is methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium.
Molecular Properties
| Compound Name | methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium |
| PubChem CID | 58427650 |
| Molecular Formula | C14H14O3SY-2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium |
| SMILES | Cc1cc[c-]cc1.Cc1cc[c-]cc1S(=O)(=O)O.[Y] |
| InChI | InChI=1S/C7H7O3S.C7H7.Y/c1-6-4-2-3-5-7(6)11(8,9)10;1-7-5-3-2-4-6-7;/h2,4-5H,1H3,(H,8,9,10);3-6H,1H3;/q2*-1; |
| InChIKey | XWXOEIUDUVYJAY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium?
The IUPAC name of methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium (CID 58427650) is methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium.
What is the SMILES notation for methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium?
The canonical SMILES for methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium is Cc1cc[c-]cc1.Cc1cc[c-]cc1S(=O)(=O)O.[Y].
What is the InChIKey of methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium?
The InChIKey is XWXOEIUDUVYJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O3S.C7H7.Y/c1-6-4-2-3-5-7(6)11(8,9)10;1-7-5-3-2-4-6-7;/h2,4-5H,1H3,(H,8,9,10);3-6H,1H3;/q2*-1;.
What are the key properties of methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium?
methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium has a molecular weight of 351.24 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylbenzene;2-methylbenzene-5-ide-1-sulfonic acid;yttrium is sourced from PubChem (CID 58427650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).