About acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium
acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium (PubChem CID 59870138) has the molecular formula C9H12N2O3SY-2
and a molecular weight of 317.18 g/mol. Its IUPAC name is acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium.
Molecular Properties
| Compound Name | acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium |
| PubChem CID | 59870138 |
| Molecular Formula | C9H12N2O3SY-2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.96 |
| IUPAC Name | acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium |
| SMILES | CC([NH-])=O.Cc1cc[c-]cc1S(N)(=O)=O.[Y] |
| InChI | InChI=1S/C7H8NO2S.C2H5NO.Y/c1-6-4-2-3-5-7(6)11(8,9)10;1-2(3)4;/h2,4-5H,1H3,(H2,8,9,10);1H3,(H2,3,4);/q-1;;/p-1 |
| InChIKey | YDKHXVQKBUHXIL-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium?
The IUPAC name of acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium (CID 59870138) is acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium.
What is the SMILES notation for acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium?
The canonical SMILES for acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium is CC([NH-])=O.Cc1cc[c-]cc1S(N)(=O)=O.[Y].
What is the InChIKey of acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium?
The InChIKey is YDKHXVQKBUHXIL-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8NO2S.C2H5NO.Y/c1-6-4-2-3-5-7(6)11(8,9)10;1-2(3)4;/h2,4-5H,1H3,(H2,8,9,10);1H3,(H2,3,4);/q-1;;/p-1.
What are the key properties of acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium?
acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium has a molecular weight of 317.18 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylazanide;2-methylbenzene-5-ide-1-sulfonamide;yttrium is sourced from PubChem (CID 59870138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).