C12H17N3O3SY+ — CID 22891027
acetylazanide;N,N-dimethyl-N'-(2-methylbenzene-5-id-1-yl)sulfonylmethanimidamide;yttrium(3+) (PubChem CID 22891027) has the molecular formula C12H17N3O3SY+ and a molecular weight of 372.26 g/mol. Its IUPAC name is acetylazanide;N,N-dimethyl-N'-(2-methylbenzene-5-id-1-yl)sulfonylmethanimidamide;yttrium(3+).
| Compound Name | acetylazanide;N,N-dimethyl-N'-(2-methylbenzene-5-id-1-yl)sulfonylmethanimidamide;yttrium(3+) |
|---|---|
| PubChem CID | 22891027 |
| Molecular Formula | C12H17N3O3SY+ |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | acetylazanide;N,N-dimethyl-N'-(2-methylbenzene-5-id-1-yl)sulfonylmethanimidamide;yttrium(3+) |
| SMILES | CC([NH-])=O.Cc1cc[c-]cc1S(=O)(=O)/N=C/N(C)C.[Y+3] |
| InChI | InChI=1S/C10H13N2O2S.C2H5NO.Y/c1-9-6-4-5-7-10(9)15(13,14)11-8-12(2)3;1-2(3)4;/h4,6-8H,1-3H3;1H3,(H2,3,4);/q-1;;+3/p-1/b11-8+;; |
| InChIKey | AOFWQFMCGCVBEM-OHENRDTHSA-M |
| XLogP | 1.66 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|