C9H11N3O5S — CID 59020339
N'-(2-hydroxy-4-nitrophenyl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 59020339) has the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. Its IUPAC name is N'-(2-hydroxy-4-nitrophenyl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-hydroxy-4-nitrophenyl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 59020339 |
| Molecular Formula | C9H11N3O5S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N'-(2-hydroxy-4-nitrophenyl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/S(=O)(=O)c1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C9H11N3O5S/c1-11(2)6-10-18(16,17)9-4-3-7(12(14)15)5-8(9)13/h3-6,13H,1-2H3/b10-6+ |
| InChIKey | JXAVXBLTZXLWSV-UXBLZVDNSA-N |
| XLogP | 0.58 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|