C19H30N4O8S — CID 90982926
[7-[2-(dimethylaminomethylideneamino)sulfonyl-5-nitrophenoxy]-4-(hydroxymethyl)-2-methylheptan-3-yl]carbamic acid (PubChem CID 90982926) has the molecular formula C19H30N4O8S and a molecular weight of 474.54 g/mol. Its IUPAC name is [7-[2-(dimethylaminomethylideneamino)sulfonyl-5-nitrophenoxy]-4-(hydroxymethyl)-2-methylheptan-3-yl]carbamic acid.
| Compound Name | [7-[2-(dimethylaminomethylideneamino)sulfonyl-5-nitrophenoxy]-4-(hydroxymethyl)-2-methylheptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 90982926 |
| Molecular Formula | C19H30N4O8S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [7-[2-(dimethylaminomethylideneamino)sulfonyl-5-nitrophenoxy]-4-(hydroxymethyl)-2-methylheptan-3-yl]carbamic acid |
| SMILES | CC(C)C(NC(=O)O)C(CO)CCCOc1cc([N+](=O)[O-])ccc1S(=O)(=O)N=CN(C)C |
| InChI | InChI=1S/C19H30N4O8S/c1-13(2)18(21-19(25)26)14(11-24)6-5-9-31-16-10-15(23(27)28)7-8-17(16)32(29,30)20-12-22(3)4/h7-8,10,12-14,18,21,24H,5-6,9,11H2,1-4H3,(H,25,26) |
| InChIKey | YOTOIBXJTWSVJA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 171.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|