C18H22BrClN6O6S — CID 91260690
N'-[2-[(4S)-4-[(5-bromo-2-chloropyrimidin-4-yl)amino]-5-hydroxypentoxy]-4-nitrophenyl]sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 91260690) has the molecular formula C18H22BrClN6O6S and a molecular weight of 565.83 g/mol. Its IUPAC name is N'-[2-[(4S)-4-[(5-bromo-2-chloropyrimidin-4-yl)amino]-5-hydroxypentoxy]-4-nitrophenyl]sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-[2-[(4S)-4-[(5-bromo-2-chloropyrimidin-4-yl)amino]-5-hydroxypentoxy]-4-nitrophenyl]sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 91260690 |
| Molecular Formula | C18H22BrClN6O6S |
| Molecular Weight | 565.83 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | N'-[2-[(4S)-4-[(5-bromo-2-chloropyrimidin-4-yl)amino]-5-hydroxypentoxy]-4-nitrophenyl]sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NS(=O)(=O)c1ccc([N+](=O)[O-])cc1OCCC[C@@H](CO)Nc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C18H22BrClN6O6S/c1-25(2)11-22-33(30,31)16-6-5-13(26(28)29)8-15(16)32-7-3-4-12(10-27)23-17-14(19)9-21-18(20)24-17/h5-6,8-9,11-12,27H,3-4,7,10H2,1-2H3,(H,21,23,24)/t12-/m0/s1 |
| InChIKey | YUJVIXKXMKAOGY-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 160.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|