C22H22BrClN6O5S — CID 58945906
1-[[2-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butoxy]-4-nitrophenyl]-methyl-oxo-λ6-sulfanylidene]-3-phenylurea (PubChem CID 58945906) has the molecular formula C22H22BrClN6O5S and a molecular weight of 597.88 g/mol. Its IUPAC name is 1-[[2-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butoxy]-4-nitrophenyl]-methyl-oxo-λ6-sulfanylidene]-3-phenylurea.
| Compound Name | 1-[[2-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butoxy]-4-nitrophenyl]-methyl-oxo-λ6-sulfanylidene]-3-phenylurea |
|---|---|
| PubChem CID | 58945906 |
| Molecular Formula | C22H22BrClN6O5S |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | 1-[[2-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butoxy]-4-nitrophenyl]-methyl-oxo-λ6-sulfanylidene]-3-phenylurea |
| SMILES | CS(=O)(=NC(=O)Nc1ccccc1)c1ccc([N+](=O)[O-])cc1OCCCCNc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C22H22BrClN6O5S/c1-36(34,29-22(31)27-15-7-3-2-4-8-15)19-10-9-16(30(32)33)13-18(19)35-12-6-5-11-25-20-17(23)14-26-21(24)28-20/h2-4,7-10,13-14H,5-6,11-12H2,1H3,(H,27,31)(H,25,26,28) |
| InChIKey | SCIXDLPATZHLCA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|