C17H19BrClN5O5S — CID 91612254
ethyl N-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butylidene-(3-nitrophenyl)-oxo-λ6-sulfanyl]carbamate (PubChem CID 91612254) has the molecular formula C17H19BrClN5O5S and a molecular weight of 520.79 g/mol. Its IUPAC name is ethyl N-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butylidene-(3-nitrophenyl)-oxo-λ6-sulfanyl]carbamate.
| Compound Name | ethyl N-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butylidene-(3-nitrophenyl)-oxo-λ6-sulfanyl]carbamate |
|---|---|
| PubChem CID | 91612254 |
| Molecular Formula | C17H19BrClN5O5S |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 519.00 |
| IUPAC Name | ethyl N-[4-[(5-bromo-2-chloropyrimidin-4-yl)amino]butylidene-(3-nitrophenyl)-oxo-λ6-sulfanyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=CCCCNc1nc(Cl)ncc1Br)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19BrClN5O5S/c1-2-29-17(25)23-30(28,13-7-5-6-12(10-13)24(26)27)9-4-3-8-20-15-14(18)11-21-16(19)22-15/h5-7,9-11H,2-4,8H2,1H3,(H,20,21,22)(H,23,25,28) |
| InChIKey | QZHLHGKRKQJXND-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|