C18H24ClIN6O3S — CID 91400290
ethyl N-[[4-amino-2-[4-[(2-chloro-5-iodopyrimidin-4-yl)amino]butylamino]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate (PubChem CID 91400290) has the molecular formula C18H24ClIN6O3S and a molecular weight of 566.85 g/mol. Its IUPAC name is ethyl N-[[4-amino-2-[4-[(2-chloro-5-iodopyrimidin-4-yl)amino]butylamino]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate.
| Compound Name | ethyl N-[[4-amino-2-[4-[(2-chloro-5-iodopyrimidin-4-yl)amino]butylamino]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate |
|---|---|
| PubChem CID | 91400290 |
| Molecular Formula | C18H24ClIN6O3S |
| Molecular Weight | 566.85 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | ethyl N-[[4-amino-2-[4-[(2-chloro-5-iodopyrimidin-4-yl)amino]butylamino]phenyl]-methylidene-oxo-λ6-sulfanyl]carbamate |
| SMILES | C=S(=O)(NC(=O)OCC)c1ccc(N)cc1NCCCCNc1nc(Cl)ncc1I |
| InChI | InChI=1S/C18H24ClIN6O3S/c1-3-29-18(27)26-30(2,28)15-7-6-12(21)10-14(15)22-8-4-5-9-23-16-13(20)11-24-17(19)25-16/h6-7,10-11,22H,2-5,8-9,21H2,1H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | BDCKPQAVEZUFPW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|