About 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide
4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide (PubChem CID 142874918) has the molecular formula C17H26N6O2S
and a molecular weight of 378.50 g/mol. Its IUPAC name is 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide |
| PubChem CID | 142874918 |
| Molecular Formula | C17H26N6O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)cc1NCCCCNc1nc(C)ncc1C |
| InChI | InChI=1S/C17H26N6O2S/c1-12-11-22-13(2)23-17(12)21-9-5-4-8-20-15-10-14(18)6-7-16(15)26(24,25)19-3/h6-7,10-11,19-20H,4-5,8-9,18H2,1-3H3,(H,21,22,23) |
| InChIKey | LNBJMMUAMYYLPR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide?
The IUPAC name of 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide (CID 142874918) is 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide.
What is the SMILES notation for 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide?
The canonical SMILES for 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide is CNS(=O)(=O)c1ccc(N)cc1NCCCCNc1nc(C)ncc1C.
What is the InChIKey of 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide?
The InChIKey is LNBJMMUAMYYLPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N6O2S/c1-12-11-22-13(2)23-17(12)21-9-5-4-8-20-15-10-14(18)6-7-16(15)26(24,25)19-3/h6-7,10-11,19-20H,4-5,8-9,18H2,1-3H3,(H,21,22,23).
What are the key properties of 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide?
4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide has a molecular weight of 378.50 g/mol, XLogP of 1.89, 9 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[4-[(2,5-dimethylpyrimidin-4-yl)amino]butylamino]-N-methylbenzenesulfonamide is sourced from PubChem (CID 142874918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).