C17H26ClN5OS — CID 143307224
N-[4-[(3-aminophenyl)sulfonimidoyl]butyl]-2-chloro-5-methylpyrimidin-4-amine;ethane (PubChem CID 143307224) has the molecular formula C17H26ClN5OS and a molecular weight of 383.95 g/mol. Its IUPAC name is N-[4-[(3-aminophenyl)sulfonimidoyl]butyl]-2-chloro-5-methylpyrimidin-4-amine;ethane.
| Compound Name | N-[4-[(3-aminophenyl)sulfonimidoyl]butyl]-2-chloro-5-methylpyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 143307224 |
| Molecular Formula | C17H26ClN5OS |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[4-[(3-aminophenyl)sulfonimidoyl]butyl]-2-chloro-5-methylpyrimidin-4-amine;ethane |
| SMILES | CC.[H]N=S(=O)(CCCCNc1nc(Cl)ncc1C)c1cccc(N)c1 |
| InChI | InChI=1S/C15H20ClN5OS.C2H6/c1-11-10-20-15(16)21-14(11)19-7-2-3-8-23(18,22)13-6-4-5-12(17)9-13;1-2/h4-6,9-10,18H,2-3,7-8,17H2,1H3,(H,19,20,21);1-2H3 |
| InChIKey | AARSBVZKPYEYFV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|