C22H41N3 — CID 58428254
N'-butyl-N'-methyl-N-[2-[[(E)-1-(2,6,6-trimethylcyclohexen-1-yl)but-2-enylidene]amino]ethyl]ethane-1,2-diamine (PubChem CID 58428254) has the molecular formula C22H41N3 and a molecular weight of 347.59 g/mol. Its IUPAC name is N'-butyl-N'-methyl-N-[2-[[(E)-1-(2,6,6-trimethylcyclohexen-1-yl)but-2-enylidene]amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-butyl-N'-methyl-N-[2-[[(E)-1-(2,6,6-trimethylcyclohexen-1-yl)but-2-enylidene]amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58428254 |
| Molecular Formula | C22H41N3 |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 347.33 |
| IUPAC Name | N'-butyl-N'-methyl-N-[2-[[(E)-1-(2,6,6-trimethylcyclohexen-1-yl)but-2-enylidene]amino]ethyl]ethane-1,2-diamine |
| SMILES | C/C=C/C(=N\CCNCCN(C)CCCC)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H41N3/c1-7-9-17-25(6)18-16-23-14-15-24-20(11-8-2)21-19(3)12-10-13-22(21,4)5/h8,11,23H,7,9-10,12-18H2,1-6H3/b11-8+,24-20+ |
| InChIKey | UWLBVYWPPLACSF-MOELVEIPSA-N |
| XLogP | 4.85 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|