C35H65N3 — CID 155596748
N-ethyl-N'-[(18Z,21Z)-4-imino-10-methylidene-7-prop-2-enylheptacosa-18,21-dienyl]ethane-1,2-diamine (PubChem CID 155596748) has the molecular formula C35H65N3 and a molecular weight of 527.93 g/mol. Its IUPAC name is N-ethyl-N'-[(18Z,21Z)-4-imino-10-methylidene-7-prop-2-enylheptacosa-18,21-dienyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[(18Z,21Z)-4-imino-10-methylidene-7-prop-2-enylheptacosa-18,21-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 155596748 |
| Molecular Formula | C35H65N3 |
| Molecular Weight | 527.93 g/mol |
| Exact Mass | 527.52 |
| IUPAC Name | N-ethyl-N'-[(18Z,21Z)-4-imino-10-methylidene-7-prop-2-enylheptacosa-18,21-dienyl]ethane-1,2-diamine |
| SMILES | [H]/N=C(\CCCNCCNCC)CCC(CC=C)CCC(=C)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C35H65N3/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-33(4)26-27-34(23-6-2)28-29-35(36)25-22-30-38-32-31-37-7-3/h6,11-12,14-15,34,36-38H,2,4-5,7-10,13,16-32H2,1,3H3/b12-11-,15-14-,36-35+ |
| InChIKey | QLYQGNMCAPXGTN-GMXXVSGGSA-N |
| XLogP | 10.11 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.93 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|