C14H21N3O2S — CID 58429255
5-N-hexyl-2,2-dioxo-1H-2λ6,3-benzothiazine-4,5-diamine (PubChem CID 58429255) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 5-N-hexyl-2,2-dioxo-1H-2λ6,3-benzothiazine-4,5-diamine.
| Compound Name | 5-N-hexyl-2,2-dioxo-1H-2λ6,3-benzothiazine-4,5-diamine |
|---|---|
| PubChem CID | 58429255 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 5-N-hexyl-2,2-dioxo-1H-2λ6,3-benzothiazine-4,5-diamine |
| SMILES | CCCCCCNc1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C14H21N3O2S/c1-2-3-4-5-9-16-12-8-6-7-11-10-20(18,19)17-14(15)13(11)12/h6-8,16H,2-5,9-10H2,1H3,(H2,15,17) |
| InChIKey | VRBQIZVCEUFXPS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|