C16H24N4O4S — CID 58429702
2-amino-N-[6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl]acetamide (PubChem CID 58429702) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-amino-N-[6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl]acetamide.
| Compound Name | 2-amino-N-[6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl]acetamide |
|---|---|
| PubChem CID | 58429702 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-amino-N-[6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl]acetamide |
| SMILES | NCC(=O)NCCCCCCOc1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C16H24N4O4S/c17-10-14(21)19-8-3-1-2-4-9-24-13-7-5-6-12-11-25(22,23)20-16(18)15(12)13/h5-7H,1-4,8-11,17H2,(H2,18,20)(H,19,21) |
| InChIKey | VZQJVYIUVHUSTL-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|