C14H21N3O6S2 — CID 58429330
6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl sulfamate (PubChem CID 58429330) has the molecular formula C14H21N3O6S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl sulfamate.
| Compound Name | 6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl sulfamate |
|---|---|
| PubChem CID | 58429330 |
| Molecular Formula | C14H21N3O6S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 6-[(4-amino-2,2-dioxo-1H-2λ6,3-benzothiazin-5-yl)oxy]hexyl sulfamate |
| SMILES | NC1=NS(=O)(=O)Cc2cccc(OCCCCCCOS(N)(=O)=O)c21 |
| InChI | InChI=1S/C14H21N3O6S2/c15-14-13-11(10-24(18,19)17-14)6-5-7-12(13)22-8-3-1-2-4-9-23-25(16,20)21/h5-7H,1-4,8-10H2,(H2,15,17)(H2,16,20,21) |
| InChIKey | BPQWANHMDOIGBP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|