C12H16N2O3S — CID 58429548
5-butoxy-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429548) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 5-butoxy-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine.
| Compound Name | 5-butoxy-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
|---|---|
| PubChem CID | 58429548 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 5-butoxy-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | CCCCOc1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C12H16N2O3S/c1-2-3-7-17-10-6-4-5-9-8-18(15,16)14-12(13)11(9)10/h4-6H,2-3,7-8H2,1H3,(H2,13,14) |
| InChIKey | PZIUJBKZDRXCCH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|