C16H22N2O3S — CID 58429557
5-(2-cyclohexylethoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429557) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 5-(2-cyclohexylethoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine.
| Compound Name | 5-(2-cyclohexylethoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
|---|---|
| PubChem CID | 58429557 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-(2-cyclohexylethoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | NC1=NS(=O)(=O)Cc2cccc(OCCC3CCCCC3)c21 |
| InChI | InChI=1S/C16H22N2O3S/c17-16-15-13(11-22(19,20)18-16)7-4-8-14(15)21-10-9-12-5-2-1-3-6-12/h4,7-8,12H,1-3,5-6,9-11H2,(H2,17,18) |
| InChIKey | BRROMRSIGSFLKT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |