C13H18N2O3S — CID 58429310
2,2-dioxo-5-pentan-3-yloxy-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429310) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2,2-dioxo-5-pentan-3-yloxy-1H-2λ6,3-benzothiazin-4-amine.
| Compound Name | 2,2-dioxo-5-pentan-3-yloxy-1H-2λ6,3-benzothiazin-4-amine |
|---|---|
| PubChem CID | 58429310 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2,2-dioxo-5-pentan-3-yloxy-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | CCC(CC)Oc1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C13H18N2O3S/c1-3-10(4-2)18-11-7-5-6-9-8-19(16,17)15-13(14)12(9)11/h5-7,10H,3-4,8H2,1-2H3,(H2,14,15) |
| InChIKey | LQKWBZGNMZZRKJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |