C12H16N2O4S — CID 58429353
5-(3-methoxypropoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429353) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 5-(3-methoxypropoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine.
| Compound Name | 5-(3-methoxypropoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
|---|---|
| PubChem CID | 58429353 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-(3-methoxypropoxy)-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | COCCCOc1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C12H16N2O4S/c1-17-6-3-7-18-10-5-2-4-9-8-19(15,16)14-12(13)11(9)10/h2,4-5H,3,6-8H2,1H3,(H2,13,14) |
| InChIKey | AOAROSSTODGQAD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|