C29H37N3O3Si — CID 58433630
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-[2-(4-cyanophenyl)-2-oxoethyl]-2-[(4-isocyano-2,3-dimethylphenyl)methyl]butanamide (PubChem CID 58433630) has the molecular formula C29H37N3O3Si and a molecular weight of 503.72 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-[2-(4-cyanophenyl)-2-oxoethyl]-2-[(4-isocyano-2,3-dimethylphenyl)methyl]butanamide.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-[2-(4-cyanophenyl)-2-oxoethyl]-2-[(4-isocyano-2,3-dimethylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 58433630 |
| Molecular Formula | C29H37N3O3Si |
| Molecular Weight | 503.72 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-N-[2-(4-cyanophenyl)-2-oxoethyl]-2-[(4-isocyano-2,3-dimethylphenyl)methyl]butanamide |
| SMILES | [C-]#[N+]c1ccc(C[C@@H](C(=O)NCC(=O)c2ccc(C#N)cc2)[C@H](C)O[Si](C)(C)C(C)(C)C)c(C)c1C |
| InChI | InChI=1S/C29H37N3O3Si/c1-19-20(2)26(31-7)15-14-24(19)16-25(21(3)35-36(8,9)29(4,5)6)28(34)32-18-27(33)23-12-10-22(17-30)11-13-23/h10-15,21,25H,16,18H2,1-6,8-9H3,(H,32,34)/t21-,25+/m0/s1 |
| InChIKey | HVFUQRBOZGXLNZ-SQJMNOBHSA-N |
| XLogP | 6.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|