C10H23NO2 — CID 58435480
N-[2-(methoxymethoxy)ethyl]-N-propylpropan-1-amine (PubChem CID 58435480) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is N-[2-(methoxymethoxy)ethyl]-N-propylpropan-1-amine.
| Compound Name | N-[2-(methoxymethoxy)ethyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 58435480 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | N-[2-(methoxymethoxy)ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CCOCOC |
| InChI | InChI=1S/C10H23NO2/c1-4-6-11(7-5-2)8-9-13-10-12-3/h4-10H2,1-3H3 |
| InChIKey | GZIGTHFUZKCWNZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|