C9H9N3O2 — CID 584402
4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-amine (PubChem CID 584402) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 584402 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,2,5-oxadiazol-3-amine |
| SMILES | COc1ccc(-c2nonc2N)cc1 |
| InChI | InChI=1S/C9H9N3O2/c1-13-7-4-2-6(3-5-7)8-9(10)12-14-11-8/h2-5H,1H3,(H2,10,12) |
| InChIKey | BWZLXMGKIFGJRA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |